| Identification | |
| Name: | Methanone,(2-hydroxyphenyl)phenyl- |
| Synonyms: | 2-Benzoylphenol;2'-Hydroxybenzophenone;NSC 623;Phenyl 2-hydroxyphenylketone;UVA 635LP;o-Benzoylphenol;Benzophenone,2-hydroxy- (6CI,7CI,8CI);(2-Hydroxyphenyl)phenylmethanone;o-Hydroxybenzophenone;o-Hydroxyphenylphenyl ketone; |
| CAS: | 117-99-7 |
| EINECS: | 204-226-2 |
| Molecular Formula: | C13H10O2 |
| Molecular Weight: | 198.22 |
| InChI: | InChI=1/C13H10O2/c14-12-9-5-4-8-11(12)13(15)10-6-2-1-3-7-10/h1-9,14H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.194 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | White or almost white powder |
| Specification: |
2-Hydroxybenzophenone , its CAS NO. is 117-99-7, the synonyms are Phenyl 2-Hydroxyphenyl ketone ; o-Benzoylphenol ; o-Hydroxybenzophenone ; Benzophenone, 2-hydroxy- (8CI) ; Methanone, (2-hydroxyphenyl)phenyl- . |
| HS Code: | 29145000 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
