| Identification |
| Name: | Combretastatin A4 |
| Synonyms: | Phenol,2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]-, (Z)-;CRC 87-09;Combretastatin 4;NSC 613729;NSC 817373; |
| CAS: | 117048-59-6 |
| Molecular Formula: | C18H20O5 |
| Molecular Weight: | 316.3484 |
| InChI: | InChI=1/C18H20O5/c1-20-15-8-7-12(9-14(15)19)5-6-13-10-16(21-2)18(23-4)17(11-13)22-3/h5-11,19H,1-4H3/b6-5+ |
| Molecular Structure: |
![(C18H20O5) Phenol,2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]-, (Z)-;CRC 87-09;Combretastatin 4;NSC 613729;...](https://img.guidechem.com/casimg/117048-59-6.gif) |
| Properties |
| Transport: | UN 2811 |
| Density: | 1.184 g/cm3 |
| Refractive index: | 1.607 |
| Appearance: | crystalline powder |
| Biological Activity: | Antitumor, antiangiogenic and antimetastatic agent, in vitro and in vivo . Acts by inhibiting tubulin polymerization (IC 50 = 2-3 μ M). |
| Usage: | Combretastatin is a small organic molecule found in the bark of the African bush willow tree Combretum caffrum. Combretastatin-A4 Prodrug Induces Mitotic Catastrophe in Chronic Lymphocytic Leukemia Cell Line Independent of Caspase Activation and Pol |
| Safety Data |
| Hazard Symbols |
T: Toxic
|
| |
 |
