| Identification |
| Name: | 1,3-Dioxane,2-(2,4-dimethyl-3-cyclohexen-1-yl)-5-methyl-5-(1-methylpropyl)- |
| Synonyms: | 5-sec-Butyl-2-(2,4-dimethyl-3-cyclohexenyl)-5-methyl-1,3-dioxane |
| CAS: | 117933-89-8 |
| EINECS: | 413-720-9 |
| Molecular Formula: | C17H30 O2 |
| Molecular Weight: | 266.42 |
| InChI: | InChI=1/C17H30O2/c1-6-14(4)17(5)10-18-16(19-11-17)15-8-7-12(2)9-13(15)3/h9,13-16H,6-8,10-11H2,1-5H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 165.8°C |
| Boiling Point: | 329.9°C at 760 mmHg |
| Density: | 0.928g/cm3 |
| Refractive index: | 1.466 |
| Water Solubility: | insoluble in water, soluble in oils and organic solvents |
| Solubility: | insoluble in water, soluble in oils and organic solvents |
| Appearance: | colourless clear liquid |
| Flash Point: | 165.8°C |
| Safety Data |
| |
 |
