| Identification | |
| Name: | 3,4,5-Trimethoxybenzoic acid |
| Synonyms: | Gallic acid trimethyl ether |
| CAS: | 118-41-2 |
| EINECS: | 204-248-2 |
| Molecular Formula: | C10H12O5 |
| Molecular Weight: | 212.2 |
| InChI: | InChI=1/C10H12O5/c1-13-7-4-6(10(11)12)5-8(14-2)9(7)15-3/h4-5H,1-3H3,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | 128.8 oC |
| Density: | 1.219 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | SLIGHTLY SOLUBLE |
| Solubility: | Insoluble AUTOIGNITION |
| Appearance: | white crystalline powder |
| Specification: | WHITE TO BEIGE FINE CRYSTALLINE POWDER usageEng:A metabolite of Trimebutine (T795605). Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| HS Code: | 29189090 |
| Flash Point: | 128.8 oC |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. Flammables-area. |
| Usage: | A metabolite of Trimebutine (T795605). |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
