| Identification | |
| Name: | 1-Naphthalenamine,N-ethyl- |
| Synonyms: | 1-Naphthylamine,N-ethyl- (6CI,7CI,8CI);1-(Ethylamino)naphthalene;Ethyl-a-naphthylamine;N-Ethyl-1-aminonaphthalene;N-Ethyl-1-naphthalenamine;N-Ethyl-1-naphthylamine;N-Ethyl-a-naphthylamine;NSC 8636; |
| CAS: | 118-44-5 |
| EINECS: | 204-250-3 |
| Molecular Formula: | C12H13N |
| Molecular Weight: | 171.24 |
| InChI: | InChI=1/C12H13N/c1-2-13-12-9-5-7-10-6-3-4-8-11(10)12/h3-9,13H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Density: | 1.065 |
| Stability: | Decomposition will not occur if used and stored according to specifications. |
| Refractive index: | 1.644 |
| Solubility: | Insoluble |
| Appearance: | Brown liquid. |
| Specification: |
N-Ethyl-1-naphthylamine (CAS NO.118-44-5), its Synonyms are 1-Naphthalenamine, N-ethyl- ; 1-Naphthylamine, N-ethyl- (8CI) ; Ethyl(1-naphthyl)amine ; 2-(Ethylamino)naphthalene ; Ethyl-alpha-naphthylamine ; N-Ethyl-alpha-naphthylamine . |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
