| Identification | |
| Name: | 1,3-Dichloro-5,5-dimethylhydantoin |
| Synonyms: | DCDMH |
| CAS: | 118-52-5 |
| EINECS: | 204-258-7 |
| Molecular Formula: | C5H6Cl2N2O2 |
| Molecular Weight: | 197.02 |
| InChI: | InChI=1/C5H6Cl2N2O2/c1-5(2)3(10)8(6)4(11)9(5)7/h1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1479 |
| Boiling Point: | 214.7 oCat 760 mmHg |
| Density: | 1.58 g/cm3 |
| Stability: | Stable, but a strong oxidizer - contact with combustible material may lead to fire. Incompatible with reducing agents, acids, strong bases. Moisture sensitive. |
| Refractive index: | 1.572 |
| Appearance: | white to off-white crystalline powder |
| Packinggroup: | II |
| HS Code: | 29332100 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from moisture. |
| Sensitive: | Moisture Sensitive |
| Color: | Four-sided, pointed prisms from chloroform White powder |
| Usage: | Dantoin(R) DCDMH is an industrial bleaching agent based on dimethyl hydantoin. This product finds application wherever solid bleach is desired. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
