| Identification |
| Name: | Benzoic acid,2-hydroxy-, 4-(acetylamino)phenyl ester |
| Synonyms: | Phenetsal(6CI); Salicylic acid, ester with 4'-hydroxyacetanilide (7CI,8CI); Salicylicacid, p-acetamidophenyl ester (4CI); 4-Acetamidophenyl salicylate;4'-Hydroxyacetanilide salicylate; Acetaminosalol; Asalphen; Cetosal; Cetosalol;Phenestal; Phenosol; Salofena; Salophen; p-Acetamidophenyl salicylate;p-Acetylaminophenyl salicylate |
| CAS: | 118-57-0 |
| EINECS: | 204-261-3 |
| Molecular Formula: | C15H13 N O4 |
| Molecular Weight: | 271.27 |
| InChI: | InChI=1/C15H13NO4/c1-10(17)16-11-6-8-12(9-7-11)20-15(19)13-4-2-3-5-14(13)18/h2-9,18H,1H3,(H,16,17) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 241.9°C |
| Boiling Point: | 476.3°Cat760mmHg |
| Density: | 1.327g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.644 |
| Appearance: | solid |
| Flash Point: | 241.9°C |
| Safety Data |
| |
 |
