| Identification | |
| Name: | Methyl 2-aminothiazole-4-carboxylate |
| Synonyms: | 2-Amino-1,3-thiazole-4-carboxylicacid methyl ester;2-Aminothiazole-4-carboxylic acid methyl ester;Methyl 2-amino-1,3-thiazole-4-carboxylate; |
| CAS: | 118452-04-3 |
| Molecular Formula: | C5H6N2O2S |
| Molecular Weight: | 158.18 |
| InChI: | InChI=1/C5H6N2O2S/c1-9-4(8)3-2-10-5(6)7-3/h2H,1H3,(H2,6,7) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 160-164 |
| Density: | 1.408 g/cm3 |
| Refractive index: | 1.606 |
| Appearance: | light yellow crystal |
| Specification: |
Methyl 2-aminothiazole-4-carboxylate , with CAS number of 118452-04-3, can be called 4-thiazolecarboxylic acid, 2-amino-, methyl ester ; Methyl 2-amino-1,3-thiazole-4-carboxylate . Methyl 2-aminothiazole-4-carboxylate (CAS NO.118452-04-3) is used as a pharmaceutical intermediate. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
