| Identification | |
| Name: | Hydrazinecarboxamide,N-(4-nitrophenyl)-2-(1H-pyrrol-2-ylmethylene)- |
| Synonyms: | Semicarbazide, 4-(p-nitrophenyl)-1-(2-pyrrolylmethylene)-;1H-Pyrrole-2-carboxaldehyde, 4-(p-nitrophenyl)semicarbazone;AC1NX9AV;LS-136692;1-(4-nitrophenyl)-3-[[(E)-pyrrol-2-ylidenemethyl]amino]urea;Hydrazinecarboxamide, N-(4-nitrophenyl)-2-(1H-pyrrol-2-ylmethylene)-;Hydrazinecarboxamide, N-(4-nitrophenyl)-2-(1H-pyrrol-2-ylmethylene)- (9CI);119034-08-1 |
| CAS: | 119034-08-1 |
| Molecular Formula: | C12H11 N5 O3 |
| Molecular Weight: | 273.28 |
| InChI: | InChI=1/C12H11N5O3/c18-12(16-14-8-10-2-1-7-13-10)15-9-3-5-11(6-4-9)17(19)20/h1-8,14H,(H2,15,16,18)/b10-8+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.43g/cm3 |
| Refractive index: | 1.674 |
| Specification: |
4-(P-nitrophenyl)semicarbazone-1h-pyrrole-2-carboxaldehyde ,with CAS number of 119034-08-1,can be called Semicarbazide, 4-(p-nitrophenyl)-1-(2-pyrrolylmethylene)- . |
| Report: |
4-(P-nitrophenyl)semicarbazone-1h-pyrrole-2-carboxaldehyde (CAS NO.119034-08-1) was reported in China International Book Trading Corp. |
| Flash Point: | °C |
| Safety Data | |
 |
|
