| Identification |
| Name: | 1-Piperidineethanol, a-(4-chlorophenyl)-4-[(4-fluorophenyl)methyl]- |
| CAS: | 119431-25-3 |
| Molecular Formula: | C20H23 Cl F N O |
| Molecular Weight: | 347.854123 |
| InChI: | InChI=1S/C20H23ClFNO/c21-18-5-3-17(4-6-18)20(24)14-23-11-9-16(10-12-23)13-15-1-7-19(22)8-2-15/h1-8,16,20,24H,9-14H2 |
| Molecular Structure: |
![(C20H23ClFNO) 1-Piperidineethanol,a-(4-chlorophenyl)-4-[(4-fluorophenyl)methyl]-,(?à)-; Eliprodil; SL 820715](https://img1.guidechem.com/chem/e/dict/30/119431-25-3.jpg) |
| Properties |
| Transport: | UN 3077 9/PG 3 |
| Density: | 1.205 g/cm3 |
| Refractive index: | 1.58 |
| Water Solubility: | DMSO: ~17 mg/mL |
| Solubility: | DMSO: ~17 mg/mL |
| Appearance: | solid |
| Biological Activity: | Non-competitive NMDA receptor antagonist that acts at the polyamine modulatory site. Selective for NR2B- over NR2A- and NR2C-containing receptors (IC 50 values are 1, > 100 and > 100 μ M respectively). Also σ 1 ligand (K i = 0.013 μ M). Antagonizes neuronal voltage-gated Ca 2+ channels and selectively inhibits the rapid component of the delayed rectifier K + current (I Kr ). Neuroprotective. |
| Storage Temperature: | 2-8°C |
| Color: | white |
| Safety Data |
| Hazard Symbols |
N: Dangerous for the environment
|
| |
 |