| Identification | |
| Name: | tranexamic acid |
| Synonyms: | trans-4-Aminomethylcyclohexane-1-carboxylate; trans-4-(Aminomethyl)cyclohexanecarboxylic acid; Amstat; amcha; trans-cyclohexanecarboxylic acid |
| CAS: | 1197-18-8 |
| EINECS: | 214-818-2 |
| Molecular Formula: | C8H15NO2 |
| Molecular Weight: | 157.21 |
| InChI: | InChI=1/C8H15NO2/c9-5-6-1-3-7(4-2-6)8(10)11/h6-7H,1-5,9H2,(H,10,11)/t6-,7- |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.096 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | 1g/6ml |
| Solubility: | 1g/6ml |
| Appearance: | white crystalline powder |
| Specification: |
?Tranexamic acid , its CAS NO. is 1197-18-8, the synonyms are trans-4-Aminomethylcyclohexane-1-carboxylate ; trans-4-(Aminomethyl)cyclohexanecarboxylic acid ; Amstat .? |
| Packinggroup: | II |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
