| Identification | |
| Name: | Ethanone,1-[2-chloro-4-(4-chlorophenoxy)phenyl]- |
| Synonyms: | 1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethanone; |
| CAS: | 119851-28-4 |
| Molecular Formula: | C14H10Cl2O2 |
| Molecular Weight: | 281.13 |
| InChI: | InChI=1/C14H10Cl2O2/c1-9(17)13-7-6-12(8-14(13)16)18-11-4-2-10(15)3-5-11/h2-8H,1H3 |
| Molecular Structure: | ![(C14H10Cl2O2) 1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethanone;](https://img.guidechem.com/casimg/119851-28-4.gif) |
| Properties | |
| Flash Point: | 146.5 ºC |
| Boiling Point: | 369.2 ºC at 760 mmHg |
| Density: | 1.304 g/cm3 |
| Refractive index: | 1.588 |
| Appearance: | light yellow to dark yellow liquid |
| Specification: |
1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethan-1-one , its cas register number is 119851-28-4. It also can be called 1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethanone ; Ethanone, 1-[2-chloro-4-(4-chlorophenoxy)phenyl]- ; 1-[2-chloro-4-(4-chlorophenoxy)phenyl]-1-ethanone ; 1-Acetyl-2-chloro-4-(4-chlorophenoxy)benzene ; 2-Chloro-4-(4-chlorophenoxy)acetophenone . You should avoid 1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethan-1-one (CAS NO.119851-28-4) contact with skin and eyes. |
| Flash Point: | 146.5 ºC |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
