| Identification | |
| Name: | Benzamide,N-(4-amino-2,5-diethoxyphenyl)- |
| Synonyms: | Benzanilide,4'-amino-2',5'-diethoxy- (6CI,7CI,8CI);1-Amino-4-(benzoylamino)-2,5-diethoxybenzene; 2,5-Diethoxy-4-benzamidoaniline;4-Amino-1-(benzoylamino)-3,6-diethoxybenzene; 4-Benzamido-2,5-diethoxyaniline;Blue Salt NBB; Brentamine Fast Blue 2B Base; Brentamine Fast Blue BB Base; FastBlue BB; Fast Blue EB Base; N-(4-Amino-2,5-diethoxyphenyl)benzamide; NSC 37184;Spectrolene Blue BB |
| CAS: | 120-00-3 |
| EINECS: | 204-363-8 |
| Molecular Formula: | C17H20 N2 O3 |
| Molecular Weight: | 300.36 |
| InChI: | InChI=1/C17H20N2O3/c1-3-21-15-11-14(16(22-4-2)10-13(15)18)19-17(20)12-8-6-5-7-9-12/h5-11H,3-4,18H2,1-2H3,(H,19,20) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1789 8 |
| Melting Point: | 98-100 ºC |
| Density: | 1.193 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.613 |
| Appearance: | Khaki powder. |
| Specification: | grey to brown powder or chunks Safety Statements:37/39-26-36/37/39 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
