| Identification | |
| Name: | 2H-1-Benzopyran-2-one,6,7-dimethoxy- |
| Synonyms: | Coumarin,6,7-dimethoxy- (6CI,7CI,8CI);6,7-Dimethylesculetin;Aesculetin dimethyl ether;Esculetin 6,7-dimethyl ether;Esculetindimethyl ether;NRB 03190;O,O-Dimethylesculetin;O-Methylisoscopoletin;O-Methylscopoletin;Scoparone;Scopoletin methyl ether;Scopoletinmonomethyl ether; |
| CAS: | 120-08-1 |
| EINECS: | 204-369-0 |
| Molecular Formula: | C11H10O4 |
| Molecular Weight: | 206.21 |
| InChI: | InChI=1/C11H10O4/c1-13-9-5-7-3-4-11(12)15-8(7)6-10(9)14-2/h3-6H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Density: | 1.248 g/cm3 |
| Refractive index: | 1.556 |
| Specification: | Safety Statements:27/28-36/37/39-45-26 27/28:After contact with skin, take off immediately all contaminated clothing and wash imediately with plenty of.... (to be specified by the manufacturer) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
