| Identification | |
| Name: | Benzenemethanol, a-methyl-, 1-propanoate |
| CAS: | 120-45-6 |
| EINECS: | 204-397-3 |
| Molecular Formula: | C11H14 O2 |
| Molecular Weight: | 178.23 |
| InChI: | InChI=1/C11H14O2/c1-3-11(12)13-9(2)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.007 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.489-1.491 |
| Water Solubility: | 0.04 g/L (20 ºC) in water |
| Solubility: | 0.04 g/L (20 ºC) in water |
| Appearance: | clear, colorless liquid. |
| Specification: | clear colorless liquid Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data | |
 |
|
