| Identification | |
| Name: | Indole |
| Synonyms: | 2,3-Benzopyrrole; 1-Benzazole; 1-Azaindene; Indol; 2,3-Benzopyrole; Benzopyrrole; Ketole; 1H-Benzo[b]pyrrole; Indole, (1-Benzazole); 1H-Indole; |
| CAS: | 120-72-9 |
| EINECS: | 204-420-7 |
| Molecular Formula: | C8H7N |
| Molecular Weight: | 117.15 |
| InChI: | InChI=1/C8H7N/c1-2-4-8-7(3-1)5-6-9-8/h1-6,9H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 3 |
| Density: | 1.22 |
| Stability: | Stable, but may be light or air sensitive. Incompatible with strong oxidizing agents, iron and iron salts. |
| Refractive index: | 1.68 |
| Solubility: | 2.80 g/L (25 oC) |
| Appearance: | white crystals with an unpleasant odour |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 2933990090 |
| Sensitive: | Light Sensitive |
| Color: | LEAFLETS (WATER, PETROLEUM), CRYSTALS (ETHER) Colorless to yellowish scales, turning red on exposure to light and air. WHITE CRYSTALLINE SOLID Colorless, shiny flakes |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
