| Identification | |
| Name: | 1,4-Methanonaphthalene-5,8-dione,1,4,4a,8a-tetrahydro- |
| Synonyms: | Cyclopentadienebenzoquinone;NSC 25329; Tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
| CAS: | 1200-89-1 |
| Molecular Formula: | C11H10 O2 |
| Molecular Weight: | 174.21 |
| InChI: | InChI=1/C11H10O2/c12-8-3-4-9(13)11-7-2-1-6(5-7)10(8)11/h1-4,6-7,10-11H,5H2 |
| Molecular Structure: | ![(C11H10O2) Cyclopentadienebenzoquinone;NSC 25329; Tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione](https://img1.guidechem.com/chem/e/dict/37/1200-89-1.jpg) |
| Properties | |
| Melting Point: | 77-79 °C(lit.) |
| Flash Point: | 118.9°C |
| Boiling Point: | 317.6°C at 760 mmHg |
| Density: | 1.273g/cm3 |
| Refractive index: | 1.592 |
| Specification: |
1,4,4a,8a-Tetrahydro-1,4-methano-naphthalene-5,8-dione with cas registry number of 1200-89-1 is also known as 1,4-Methanonaphthalene-5,8-dione,1,4,4a,8a-tetrahydro- ; Tricyclo[6.2.1.0~2,7~]undeca-4,9-diene-3,6-dione ; (1RS,4SR,4aRS,8aSR)-1,4,4a,8a-Tetrahydro[1,4-methanonaphtalen]-5,8-dione ; 1, 4-Methanonaphthalene-5,8-dione, 1,4,4a,8a-tetrahydro- ; 1,4,4-.Alpha.,8-.alpha.-tetrahydro-endo-1,4-methanonaphthalene-5,8-dione ; 1,4,4a,8a-Tetrahydro-1,4-methanonaphthalene-5,8-dione ; 1,4,4a,8a-Tetrahydro-endo-1,4-methanonaphthalene-5,8-dione ; 1,4,4-Alpha,8-alpha-tetrahydro-endo-1,4-methanonaphthalene-5,8-dione ; Cyclopentadienebenzoquinone ; Endo-Tricyclo[6.2.1.0(2,7)]undeca-4,9-diene-3,6-dione . 1,4,4a,8a-Tetrahydro-1,4-methano-naphthalene-5,8-dione with cas registry number of 1200-89-1 is used as a pharmaceutical intermediate for the analysis of more complex chemical compounds. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 118.9°C |
| Safety Data | |
 |
|
