| Identification |
| Name: | 1H-Inden-1-one,2,3-dihydro-5,6-dimethoxy-2-[[1-(phenylmethyl)-4-piperidinyl]methylene]- |
| Synonyms: | 1-Benzyl-4-[(5,6-dimethoxy-1-oxoindan-2-ylidene)methyl]piperidine;2-(1-Benzylpiperidin-4-ylmethylidene)-5,6-dimethoxyindan-1-one; |
| CAS: | 120014-07-5 |
| Molecular Formula: | C24H27NO3 |
| Molecular Weight: | 377.48 |
| InChI: | InChI=1/C24H27NO3/c1-27-22-14-19-13-20(24(26)21(19)15-23(22)28-2)12-17-8-10-25(11-9-17)16-18-6-4-3-5-7-18/h3-7,12,14-15,17H,8-11,13,16H2,1-2H3/b20-12+ |
| Molecular Structure: |
![(C24H27NO3) 1-Benzyl-4-[(5,6-dimethoxy-1-oxoindan-2-ylidene)methyl]piperidine;2-(1-Benzylpiperidin-4-ylmethylide...](https://img.guidechem.com/casimg/120014-07-5.gif) |
| Properties |
| Flash Point: | 282.06°C |
| Boiling Point: | 542.774°C at 760 mmHg |
| Density: | 1.209g/cm3 |
| Refractive index: | 1.636 |
| Specification: |
1-Benzyl-4-(5,6-dimethoxy-1-oxoindan-2-ylindenemethyl)piperidine , its cas register number is 120014-07-5. It also can be called 2-[(1-Benzyl-4-piperidyl)methyleen]-5,6-dimethoxyindan-1-on ; 1H-Inden-1-one,2,3-dihydro-5,6-dimethoxy-2-[[1-(phenylmethyl)-4-piperidinyl]methylene]- .
|
| Flash Point: | 282.06°C |
| Usage: | An impurity of Donepezil; an intermediate as an anti-Alzheimer agent. |
| Safety Data |
| |
 |