| Identification | |
| Name: | TETRAMETHOXYSILANE POLYMER |
| Synonyms: | Silicic acid, methyl ester;METHYLHYDROGENSILOXANE;methyl silicate 51;silicon methylate;tetramethoxysilane polymer;Methyl Poly |
| CAS: | 12002-26-5 |
| EINECS: | 234-412-9 |
| Molecular Formula: | C4H12O4Si |
| Molecular Weight: | 92.12616 |
| InChI: | InChI=1/CH4O3Si/c1-4-5(2)3/h2H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -1 deg C |
| Flash Point: | 28.9°C |
| Boiling Point: | 121.2°Cat760mmHg |
| Density: | 0.977g/cm3 |
| Refractive index: | 1.393 [20°C] |
| Solubility: | Very soluble in ethanol SOL IN ORGANIC SOLVENTS Not soluble in water |
| Specification: |
1.Tetramethoxysilane polymer (12002-26-5) break down into a sticky silica in case of water, can cause burning when meeting with fire, heat or direct contact with oxidants, decompose toxic gases when heated, |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 28.9°C |
| Color: | Colorless liquid Clear, colorless liquid [Note: A solid below 28 degrees F]. |
| Safety Data | |
 |
|
