| Identification |
| Name: | Indole-2-carboxylic acid methyl ester |
| Synonyms: | 2-Indolecarboxylic acid methyl ester; Methyl indole-2-carboxylate; Methyl-2-Indolecarboxylate |
| CAS: | 1202-04-6 |
| EINECS: | 214-861-7 |
| Molecular Formula: | C10H9NO2 |
| Molecular Weight: | 175.19 |
| InChI: | InChI=1/C10H9NO2/c1-13-10(12)9-6-7-4-2-3-5-8(7)11-9/h2-6,11H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | HAZARD |
| Flash Point: | Not considered to be a fire hazard |
| Density: | 1.253 g/cm3 |
| Refractive index: | 1.639 |
| Solubility: | 470 (mg/l) SOLVENT |
| Appearance: | off white crystals |
| Flash Point: | Not considered to be a fire hazard |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
