| Identification | |
| Name: | Copper(II) carbonate basic |
| Synonyms: | Copper(II) hydroxide carbonate; Cupric carbonate, basic; Copper(II) carbonate, basic; Cupric Carbonate Basic; Copper(II) carbonate; Coppercarbonatebasicbluegreenpowder; copper carbonate (II)-copper hydroxide (II) (1:1); Copperhydroxidecarbonate; Cupric carbonate |
| CAS: | 12069-69-1 |
| EINECS: | 235-113-6 |
| Molecular Formula: | CuCO3?Cu?(OH)2 |
| Molecular Weight: | 221.11 |
| InChI: | InChI=1/CH2O3.2Cu.2H2O/c2-1(3)4;;;;/h(H2,2,3,4);;;2*1H2/q;2*+2;;/p-4 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN3288 |
| Density: | 4 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble in water |
| Appearance: | Fine green powder |
| Report: |
Copper and its compounds are on the Community Right-To-Know List. Copper(II) carbonate basic (CAS NO.12069-69-1) is reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Used to treat seeds for fungus. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
