| Identification | |
| Name: | Aluminum,(N,N-diethylethanamine)trihydro-, (T-4)- |
| Synonyms: | Aluminum,trihydro(triethylamine)- (6CI,7CI,8CI); Alane compound with triethylamine(1:1); Aluminum hydride (AlH3), compd. with N,N-diethylethanamine (1:1);Aluminum hydride(AlH3) compound with triethylamine (1:1); Aluminum trihydridetriethylamine adduct; Ethanamine, N,N-diethyl-, compd. with aluminum hydride(AlH3) (1:1); Triethylamine compound with aluminum hydride (AlH3) (1:1);Triethylamine, compd. with aluminum hydride (AlH3) (1:1); Triethylaminoaluminumhydride |
| CAS: | 12076-08-3 |
| EINECS: | 235-138-2 |
| Molecular Formula: | C6H18 Al N |
| Molecular Weight: | 131.195358 |
| InChI: | InChI=1/C6H15N.Al/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;/q;+3/p+3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | 90.5°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | °C |
| Safety Data | |
 |
|
