| Identification | |
| Name: | Bicyclo[2.2.1]hepta-2,5-diene |
| Synonyms: | 2,5-Norbornadiene; bicyclo(2.2.1)hepta-2,5-diene; 8,9,10-trinorborna-2,5-diene; Bicyclo(2,2,1)hepta-2,5-diene; Norbornadine; 99%; 2,5-Norbornadine |
| CAS: | 121-46-0 |
| EINECS: | 204-472-0 |
| Molecular Formula: | C7H8 |
| Molecular Weight: | 92.14 |
| InChI: | InChI=1/C7H8/c1-2-7-4-3-6(1)5-7/h1-4,6-7H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2251 |
| Flash Point: | 12? |
| Density: | 0.906 |
| Stability: | Unstable. |
| Refractive index: | 1.470 |
| Solubility: | Slightly soluble |
| Appearance: | A colorless liquid with a hydrocarbon odor. |
| Specification: | Clear colorless to slightly yellow liquid usageEng:Intermediate in prostaglandin synthesis.1 Safety Statements:16-23 16:Keep away from sources of ignition - No smoking 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) |
| Packinggroup: | II |
| HS Code: | 29021990 |
| Flash Point: | 12? |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. Keep under a nitrogen blanket. Flammables-area. |
| Usage: | Used in a number of high technology applications in the fields of material science agriculture and pharmaceuticals. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
