| Identification | |
| Name: | N,N-Dimethylaniline |
| Synonyms: | N,N-Dimethyl aniline; N,N-Dimethylbenzenamine; NN-Dimethylaniline 99.0 % (GLC) for analysis |
| CAS: | 121-69-7 |
| EINECS: | 204-493-5 |
| Molecular Formula: | C8H11N |
| Molecular Weight: | 121.18 |
| InChI: | InChI=1/C8H11N/c1-9(2)8-6-4-3-5-7-8/h3-7H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2253 |
| Density: | 0.956 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong acids, acid chlorides, acid anhydrides, chloroformates, halogens. Combustible. |
| Refractive index: | 1.557-1.559 |
| Solubility: | Negligible |
| Appearance: | Pale Yellow to brown oily liquid, amine-like odor |
| Packinggroup: | II |
| Color: | Pale-yellow, oily liquid [Note: A solid below 36 degrees F]. Yellowish to brownish, oily liquid |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
