| Identification | ||
| Name: | m-Nitroacetophenone | |
| Synonyms: | 1-(3-Nitrophenyl)ethanone; 3-Nitroacetophenone; 3'-Nitroacetophenone | |
| CAS: | 121-89-1 | |
| EINECS: | 204-504-3 | |
| Molecular Formula: | C8H7NO3 | |
| Molecular Weight: | 165.15 | |
| InChI: | InChI=1/C8H7NO3/c1-6(10)7-3-2-4-8(5-7)9(11)12/h2-5H,1H3 | |
| Molecular Structure: |  |
|
| Properties | ||
| Density: | 1.243 g/cm3 | |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases. | |
| Refractive index: | 1.558 | |
| Water Solubility: | <0.01 g/100 mL at 20 ºC | |
| Solubility: | <0.01 g/100 mL at 20 oC | |
| Appearance: | white to light beige crystalline powder | |
| Specification: | white to light beige crystalline powder Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes | |
| Packinggroup: | Z01 | |
| HS Code: | 29147090 | |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. | |
| Color: | NEEDLES FROM ALCOHOL | |
| Usage: | M-nitroacetophenone is an anthropogenic compound which is used as a synthetic intermediate in the production of dyes and other organic compounds. | |
| Safety Data | ||
| Hazard Symbols |
Xn:Harmful
|
|
 |
||
