| Identification | |
| Name: | Thiourea,N,N'-dicyclohexyl- |
| Synonyms: | Urea,1,3-dicyclohexyl-2-thio- (6CI,7CI,8CI);1,3-Bis(cyclohexyl)thiourea;1,3-Dicyclohexyl-2-thiourea;Dicyclohexylthiourea;N,N'-Dicyclohexylthiocarbamide;N,N'-Dicyclohexylthiourea;NSC 33443;sym-Dicyclohexylthiourea; |
| CAS: | 1212-29-9 |
| EINECS: | 214-920-7 |
| Molecular Formula: | C13H24N2S |
| Molecular Weight: | 240.41 |
| InChI: | InChI=1/C13H24N2S/c16-13(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h11-12H,1-10H2,(H2,14,15,16) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Melting Point: | 33 °C |
| Flash Point: | 162.6°C |
| Boiling Point: | 345.3°Cat760mmHg |
| Density: | 1.05g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.55 |
| Solubility: | <0.01 g/100 mL at 21 ºC |
| Appearance: | White crystals. |
| Specification: |
Dicyclohexylthiourea ,its CAS NO. is 1212-29-9,the synonyms is 1,3-Bis(cyclohexyl)thiourea;1,3-dicyclohexyl-2-thio-ure ; Dicyclohexylthiourea ; n,n'-Dicyclohexylthiocarbamide ; Nci-c04524 ; Sym-dicyclohexythiourea ; n,n-Dicyclohexylthiourea ; 1,3-Dicyclohexyl-2-thiourea . |
| Report: |
NCI Carcinogenesis Bioassay (feed); No Evidence: mouse, rat NCITR* National Cancer Institute Carcinogenesis Technical Report Series. (Bethesda, MD 20014) No. NCI-CG-TR-56 ,1978. . Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 162.6°C |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Usage: | Chemical intermediate for dicyclohexylcarbodiimide (no evidence of current use). |
| Safety Data | |
 |
|
