| Identification | |
| Name: | 2,3-Difluorophenylboronic acid |
| Synonyms: | 2,3-Difluorobenzeneboronic acid;2,3-Difluorobenzene boronic acid;2,3-Difluoro phenylboric acid;Boronic acid, B-(2,3-difluorophenyl)-;Boronic acid, (2,3-difluorophenyl)- (9CI); |
| CAS: | 121219-16-7 |
| EINECS: | -0 |
| Molecular Formula: | C6H5BF2O2 |
| Molecular Weight: | 157.91 |
| InChI: | InChI=1/C6H5BF2O2/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3,10-11H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 120oC |
| Boiling Point: | 274.8 oC at 760 mmHg |
| Density: | 1.35 g/cm3 |
| Refractive index: | 1.485 |
| Appearance: | off-white to light beige crystalline powder |
| Specification: |
? 2,3-Difluorophenylboronic acid (CAS NO.121219-16-7), its Synonyms are 2,3-Difluorophenylboronic acid, 97+% ; 2,3-Difluorobenzeneboronic acid 98% ; 2,3-Difluorophenylboronic Acid (contains varying amounts of Anhydride) . It is off-white to light beige crystalline powder. |
| Flash Point: | 120oC |
| Usage: | 2,3-Difluorophenylboronic acid (CAS NO.121219-16-7) is used as intermediates of liquid crystals. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
