| Identification | |
| Name: | Malonaldehyde bis(diethyl acetal) |
| Synonyms: | Tetraethoxypropane,95%; 1,1,3,3-Tetraethoxypropane |
| CAS: | 122-31-6 |
| EINECS: | 204-533-1 |
| Molecular Formula: | C11H24O4 |
| Molecular Weight: | 220.31 |
| InChI: | InChI=1/C11H24O4/c1-5-12-10(13-6-2)9-11(14-7-3)15-8-4/h10-11H,5-9H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1993 |
| Density: | 0.919 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.41-1.412 |
| Water Solubility: | insoluble |
| Solubility: | Water Solubility :insoluble |
| Appearance: | Colorless to light yellow liquid. |
| Specification: |
Malonaldehyde bis(diethyl acetal) , its CAS NO. is 122-31-6, the synonyms are Malonaldehyde diethyl acetal ; Malonaldehyde tetraethyl acetal ; Malonaldehyde tetraethyl diacetal ; Malondialdehyde tetraethylacetal ; 1,1,3,3-Tetraethoxypropane ; Propane, 1,1,3,3-tetraethoxy- ; Tetraethoxy propane ; Tetraethoxypropane ; Tetraethyl malondialdehyde acetal . Malonaldehyde bis(diethyl acetal) (CAS NO.122-31-6) is stable under normal temperatures and pressures but incompatible with strong oxidizing agents, strong acids.Hazardous decomposition products are carbon monoxide, carbon dioxide.Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Flammables-area. |
| Packinggroup: | III |
| HS Code: | 29110000 |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
