| Identification | |
| Name: | Heptanal,2-(phenylmethylene)- |
| Synonyms: | Cinnamaldehyde,a-amyl- (4CI);Cinnamaldehyde, a-pentyl- (6CI,7CI,8CI);2-(Phenylmethylene)heptanal;2-Benzylideneheptanal;Amylcinnamic acid aldehyde;Amylcinnamic aldehyde;Flomine;Jasminal;Jasminaldehyde;Jasmine aldehyde;NSC 6649;Pentylcinnamaldehyde;a-Amyl-b-phenylacrolein;a-Amylcinnamal;a-Amylcinnamaldehyde;a-Pentylcinnamaldehyde;Alpha-amyl cinnamaldehyde; |
| CAS: | 122-40-7 |
| EINECS: | 204-541-5 |
| Molecular Formula: | C14H18O |
| Molecular Weight: | 202.29 |
| InChI: | InChI=1/C14H18O/c1-2-3-5-10-14(12-15)11-13-8-6-4-7-9-13/h4,6-9,11-12H,2-3,5,10H2,1H3/b14-11- |
| Molecular Structure: |  |
| Properties | |
| Transport: | 190kgs |
| Density: | 0.97 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.554-1.557 |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | clear to pale yellow liquid |
| Specification: | Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Storage Temperature: | Keep tightly closed. Store at 2-8 C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
