| Identification | |
| Name: | 2-Butanone,4-(4-hydroxy-3-methoxyphenyl)- |
| Synonyms: | Zingiberone;Zingerone;NSC 15335;Gingerone;4-Hydroxy-3-methoxybenzylacetone;4-(4-Hydroxy-3-methoxyphenyl)-2-butanone;3-Methoxy-4-hydroxybenzylacetone;(4-Hydroxy-3-methoxyphenyl)ethylmethyl ketone; |
| CAS: | 122-48-5 |
| EINECS: | 204-548-3 |
| Molecular Formula: | C11H14O3 |
| Molecular Weight: | 194.23 |
| InChI: | InChI=1/C11H14O3/c1-8(12)3-4-9-5-6-10(13)11(7-9)14-2/h5-7,13H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.14 |
| Stability: | No data. |
| Refractive index: | 1.541 |
| Solubility: | Insoluble |
| Appearance: | Clear slightly yellow liquid. |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II; III |
| HS Code: | 29333999 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Crystals from acetone, petroleum ether, ether plus petroleum ether |
| Usage: | Flavor ingredient. |
| Safety Data | |
 |
|
