Identification |
Name: | Triethyl Orthoformate |
Synonyms: | Ethyl orthoformate; Orthoformic acid triethyl ester |
CAS: | 122-51-0 |
EINECS: | 204-550-4 |
Molecular Formula: | C7H16O3 |
Molecular Weight: | 148.2 |
InChI: | InChI=1/C7H16O3/c1-4-8-7(9-5-2)10-6-3/h7H,4-6H2,1-3H3 |
Molecular Structure: |
 |
Properties |
Transport: | UN 2524 |
Density: | 0.891 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.39-1.392 |
Water Solubility: | 1.35 g/L |
Solubility: | 1.35 g/L in water |
Appearance: | colorless liquid, with spicy odor |
Specification: |
European/International Regulations
European Labeling in Accordance with EC Directives
|
Packinggroup: | III |
HS Code: | 29159080 |
Storage Temperature: | Flammables area |
Sensitive: | Moisture Sensitive |
Usage: | Used to make other chemicals. |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |