| Identification | |
| Name: | Triethyl Orthoformate |
| Synonyms: | Ethyl orthoformate; Orthoformic acid triethyl ester |
| CAS: | 122-51-0 |
| EINECS: | 204-550-4 |
| Molecular Formula: | C7H16O3 |
| Molecular Weight: | 148.2 |
| InChI: | InChI=1/C7H16O3/c1-4-8-7(9-5-2)10-6-3/h7H,4-6H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2524 |
| Density: | 0.891 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.39-1.392 |
| Water Solubility: | 1.35 g/L |
| Solubility: | 1.35 g/L in water |
| Appearance: | colorless liquid, with spicy odor |
| Specification: |
European/International Regulations |
| Packinggroup: | III |
| HS Code: | 29159080 |
| Storage Temperature: | Flammables area |
| Sensitive: | Moisture Sensitive |
| Usage: | Used to make other chemicals. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
