| Identification | |
| Name: | Tributylborane |
| Synonyms: | Tributylborane solution; Tri-n-butylborane; Boronbutoxide |
| CAS: | 122-56-5 |
| EINECS: | 204-554-6 |
| Molecular Formula: | C12H27B |
| Molecular Weight: | 182.15 |
| InChI: | InChI=1/C12H27B/c1-4-7-10-13(11-8-5-2)12-9-6-3/h4-12H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2845 4.2/PG 1 |
| Melting Point: | -34 °C |
| Density: | 0.83 |
| Refractive index: | 1.4285 |
| Specification: | colorless to pale yellow liquid Safety Statements:7-23-26-36/37/39-43-45-16 7:Keep container tightly closed 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 43:In case of fire, use ... (indicate in the space the precise type of fire-fighting equipment. If water increases the risk add - Never use water) 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 16:Keep away from sources of ignition - No smoking |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | I |
| Storage Temperature: | Flammables area |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
F:Highlyflammable
C:Corrosive
|
 |
|
