| Identification | |
| Name: | 3-Buten-2-one,4-phenyl- |
| Synonyms: | 2-Butenone,4-phenyl- (2CI);Ketone, methyl styryl (7CI);1-Phenyl-1-buten-3-one;2-Phenylethenyl methyl ketone;2-Phenylvinyl methyl ketone;4-Phenyl-3-buten-2-one;4-Phenyl-3-butene-2-one;4-Phenylbutenone;Acetocinnamone;Methyl 2-phenylvinyl ketone;Methyl phenylvinyl ketone;Methyl styryl ketone;Methyl b-styryl ketone;NSC 5605;Styrylmethyl ketone; |
| CAS: | 122-57-6 |
| EINECS: | 204-555-1 |
| Molecular Formula: | C10H10O |
| Molecular Weight: | 146.19 |
| InChI: | InChI=1/C10H10O/c1-9(11)7-8-10-5-3-2-4-6-10/h2-8H,1H3/b8-7+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.0377 |
| Refractive index: | 1.5836 |
| Solubility: | 1.3 g/L (20 C) |
| Appearance: | Colorless solid |
| Specification: | Yellow Solid Safety Statements:7-26-36/37/39-45-37/39-24-36/37-22 7:Keep container tightly closed 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 37/39:Wear suitable protective clothing, gloves and eye/face protection 24:Avoid contact with skin 36/37:Wear suitable protective clothing and gloves 22:Do not breathe dust |
| HS Code: | 29143900 |
| Sensitive: | Light Sensitive |
| Usage: | Substance is used in as an aroma for perfumes, organic syntheses. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
