| Identification | |
| Name: | Phenyl Glycidyl Ether |
| Synonyms: | (+/-)-1,2-Epoxy-3-phenoxypropane; 1,2-Epoxy-3-phenoxypropane; 2,3-epoxypropyl phenyl ether; 3-phenoxy-1,2-epoxypropane; benzene, (2,3-epoxypropoxy)-; Glycidyl Phenyl Ether; PGE; (phenoxymethyl)oxirane; phenoxypropene oxide; Phenyl 2,3-epoxypropyl ether; PHENYL GLYCIDYL ETHER (1,2-EPOXY-3-PHENOXYPROPANE); |
| CAS: | 122-60-1 |
| EINECS: | 204-557-2 |
| Molecular Formula: | C9H10O2 |
| Molecular Weight: | 150.18 |
| InChI: | InChI=1/C9H10O2/c1-2-4-8(5-3-1)10-6-9-7-11-9/h1-5,9H,6-7H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.108 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.5295-1.5315 |
| Solubility: | 2.4 g/L (20 ºC) |
| Appearance: | colourless liquid |
| Specification: | colourless liquid Safety Statements:53-45-61 53:Avoid exposure - obtain special instruction before use 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Packinggroup: | Z01 |
| HS Code: | 29109000 |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Colorless liquid (Note: A solid below 38 degrees F) |
| Usage: | Intermediate & stabilizer of halogenated compound. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
