| Identification | |
| Name: | 2-Propenoic acid,3-phenyl-, 3-phenylpropyl ester |
| Synonyms: | Cinnamicacid, 3-phenylpropyl ester (7CI,8CI); Hydrocinnamyl cinnamate; Phenylpropylcinnamate |
| CAS: | 122-68-9 |
| EINECS: | 204-565-6 |
| Molecular Formula: | C18H18 O2 |
| Molecular Weight: | 266.36 |
| InChI: | InChI=1/C18H18O2/c19-18(14-13-17-10-5-2-6-11-17)20-15-7-12-16-8-3-1-4-9-16/h1-6,8-11,13-14H,7,12,15H2/b14-13- |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.091 g/cm3 |
| Refractive index: | 1.589 |
| Water Solubility: | insoluble in water; soluble in oils |
| Solubility: | insoluble in water; soluble in oils |
| Appearance: | colorless clear liquid |
| Specification: |
3-Phenylpropyl cinnamate , its cas register number is 122-68-9. It also can be called Cinnamic acid, 3-phenylpropyl ester ; 3-Phenylpropyl 3-phenyl-2-propenoate ; and Hydrocinnamyl 3-phenylpropenoate . |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
 |
|
