| Identification | |
| Name: | Glycine,N-(4-hydroxyphenyl)- |
| Synonyms: | Glycine,N-(p-hydroxyphenyl)- (6CI,7CI,8CI);4-(Carboxymethylamino)phenol;Iconyl;Monazol;N-(4-Hydroxyphenyl)glycine;N-(p-Hydroxyphenyl)glycine;NSC 9267;Photoglycine;p-Hydroxyanilinoacetic acid;p-Hydroxyphenylaminoacetic acid;p-Hydroxyphenylglycine; |
| CAS: | 122-87-2 |
| EINECS: | 204-580-8 |
| Molecular Formula: | C8H9NO3 |
| Molecular Weight: | 167.16 |
| InChI: | InChI=1/C8H9NO3/c10-7-3-1-6(2-4-7)9-5-8(11)12/h1-4,9-10H,5H2,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.411g/cm3 |
| Appearance: | white to beige-brown or brown-grey powder |
| Specification: | white to beige-brown or brown-grey powder Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
