| Identification | |
| Name: | Benzenemethanol,4-methoxy-, 1-formate |
| Synonyms: | Anisylalcohol, formate (6CI); Benzenemethanol, 4-methoxy-, formate (9CI); Benzylalcohol, p-methoxy-, formate (8CI); 4-Methoxybenzyl formate; Anisyl formate;NSC 5949; p-Methoxybenzyl alcohol, formate; p-Methoxybenzyl formate |
| CAS: | 122-91-8 |
| EINECS: | 204-582-9 |
| Molecular Formula: | C9H10 O3 |
| Molecular Weight: | 166.17 |
| InChI: | InChI=1/C9H10O3/c1-11-9-4-2-8(3-5-9)6-12-7-10/h2-5,7H,6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 100.6°C |
| Boiling Point: | 254.8°Cat760mmHg |
| Density: | 1.108g/cm3 |
| Refractive index: | n20/D 1.523(lit.) |
| Specification: | Safety Statements:26 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Flash Point: | 100.6°C |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
