| Identification |
| Name: | Cyclohexanone,(1,3-benzodioxol-5-ylmethyl)- (9CI) |
| Synonyms: | Cyclohexanone,piperonyl- (8CI); Piperonyl cyclohexanone |
| CAS: | 12261-99-3 |
| Molecular Formula: | C14H16 O3 |
| Molecular Weight: | 232.30 |
| InChI: | InChI=1/C14H16O3/c15-12-4-2-1-3-11(12)7-10-5-6-13-14(8-10)17-9-16-13/h5-6,8,11H,1-4,7,9H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 167.7°C |
| Boiling Point: | 367.9°Cat760mmHg |
| Density: | 1.207g/cm3 |
| Refractive index: | 1.569 |
| Specification: |
Piperonyl cyclohexanone , its cas register number is 12261-99-3. It also can be called Cyclohexanone, piperonyl- ;
CID202582 ; LS-57356 . When heated to decomposition it emits acrid smoke and irritating vapors.
|
| Flash Point: | 167.7°C |
| Safety Data |
| |
 |