Identification |
Name: | Nickel,[[2-[(dithiocarboxy)amino]ethyl]carbamodithioato(2-)-kS,kS']- |
Synonyms: | Nickel,[[1,2-ethanediylbis[carbamodithioato]](2-)]-; Carbamodithioic acid,1,2-ethanediylbis-, nickel complex; (1,2-Ethylenebisdithiocarbamato)nickel |
CAS: | 12275-13-7 |
Molecular Formula: | C4H6 N2 Ni S4 |
Molecular Weight: | 269.07 |
InChI: | InChI=1/C4H8N2S4.Ni/c7-3(8)5-1-2-6-4(9)10;/h1-2H2,(H2,5,7,8)(H2,6,9,10);/q;+2/p-2 |
Molecular Structure: |
|
Properties |
Flash Point: | 140.2°C |
Boiling Point: | 308.2°Cat760mmHg |
Density: | g/cm3 |
Report: |
NTP 10th Report on Carcinogens. Nickel and its compounds are on the Community Right-To-Know List.
|
Flash Point: | 140.2°C |
Safety Data |
|
|