| Identification | |
| Name: | p-Anisaldehyde |
| Synonyms: | p-Formylanisole;p-Methoxybenzaldehyde;4-Anisaldehyde;4-Methoxybenzaldehyde;Anisaldehyde;Anisic aldehyde;Aubepine;Crategine;NSC 5590;Obepin;p-Anisic aldehyde; |
| CAS: | 123-11-5 |
| EINECS: | 204-602-6 |
| Molecular Formula: | C8H8O2 |
| Molecular Weight: | 136.15 |
| InChI: | InChI=1/C8H8O2/c1-10-8-4-2-7(6-9)3-5-8/h2-6H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 225kgs |
| Density: | 1.121 |
| Stability: | Stable under normal temperatures and pressures. Volatile in steam. |
| Refractive index: | 1.571-1.574 |
| Water Solubility: | Insoluble (soluble in alcohol, ether) |
| Solubility: | Insoluble (soluble in alcohol, ether) |
| Appearance: | Clear to slight yellow liquid |
| Specification: |
Precautions: Do not ingest. Do not breathe gas/fumes/vapor/spray.?Keep away from heat. Keep away from sources of ignition. Avoid contact with skin and eyes. Empty containers pose a fire risk, evaporate the residue under a fume hood. Ground all equipment containing material. Wear suitable protective clothing. In case of insufficient ventilation, wear suitable respiratory equipment. If ingested, seek medical advice immediately and show the container or the label. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | I; II; III |
| HS Code: | 29124900 |
| Storage Temperature: | Refrigerator |
| Sensitive: | Air Sensitive |
| Color: | OILY LIQ COLORLESS TO SLIGHTLY YELLOW |
| Usage: | In organic synthesis. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
