| Identification | |
| Name: | 3,6-Dihydroxypyridazine |
| Synonyms: | 3,6-Pyridazinediol; Maleic acid hydrazide; Maleic hydrazide,(3,6-Dihydroxypyridazine; 3,6-Pyridazinediol); 1,2-dihydropyridazine-3,6-dione; Maleic Hydrazine; 1,2-Dihydropyridazin-3,6-dion; Maleic hydrazide; cis-Butenedioic acid hydrazide; 1,2-Dihydro-3,6-pyridazinedione |
| CAS: | 123-33-1 |
| EINECS: | 204-619-9 |
| Molecular Formula: | C4H4N2O2 |
| Molecular Weight: | 112.09 |
| InChI: | InChI=1/C4H4N2O2/c7-3-1-2-4(8)6-5-3/h1-2H,(H,5,7)(H,6,8) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 |
| Density: | 1.6 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.649 |
| Water Solubility: | 6 g/L |
| Solubility: | slightly soluble (slightly soluble in alcihol) SOLVENT |
| Appearance: | white cystals |
| HS Code: | 29339990 |
| Color: | Crystals from water COLORLESS CRYSTALLINE SOLID |
| Usage: | Experimental use: in horticulture & agriculture, in synthesis of pyridazine. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
