| Identification | |
| Name: | Succinimide |
| Synonyms: | dihydro-3-pyrroline-2,5-dione;Butanimide;2, 5-Dioxopyrrolidine;Lubrizol 6406;Succinic imide;2,4,6-Trichlorophenyl hydrazine;Succinic acid imide;pyrrolidine-2,5-dione;L 113B;2,5-dioxopyrrolidine;2,5-Pyrrolidinedione;3, 4-Dihydropyrrolidine;3,4-dihydropyrrole-2,5-dione;Succinimide-Sauba;2,5-Diketopyrrolidine; |
| CAS: | 123-56-8 |
| EINECS: | 204-635-6 |
| Molecular Formula: | C4H5NO2 |
| Molecular Weight: | 99.09 |
| InChI: | InChI=1/C4H5NO2/c6-3-1-2-4(7)5-3/h1-2H2,(H,5,6,7) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.41 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.479 |
| Water Solubility: | Soluble |
| Solubility: | Soluble |
| Appearance: | A white crystalline powder |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | Z01 |
| HS Code: | 29251995 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Used in a variety of organic synthesis, as well as in some industrial silver plating processes. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
