| Identification |
| Name: | Allyl hexanoate |
| Synonyms: | Hexanoicacid, 2-propenyl ester (9CI);Hexanoic acid, allyl ester (6CI,7CI,8CI);Allylalcohol, hexanoate (6CI);2-Propenyl hexanoate;Allyl caproate;Allylcapronate;NSC 20962; |
| CAS: | 123-68-2 |
| EINECS: | 204-642-4 |
| Molecular Formula: | C9H16O2 |
| Molecular Weight: | 156.22 |
| InChI: | InChI=1/C9H16O2/c1-3-5-6-7-9(10)11-8-4-2/h4H,2-3,5-8H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2810 |
| Density: | 0.882 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4236-1.4256 |
| Water Solubility: | PRACTICALLY INSOLUBLE |
| Solubility: | Insoluble |
| Appearance: | clear, colorless liquid. |
| Packinggroup: | III |
| HS Code: | 29159080 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |
