| Identification | |
| Name: | Pymetrozine |
| Synonyms: | 1,2,4-Triazin-3(2H)-one, 4,5-dihydro-6-methyl-4-((3-pyridinylmethylene)amino)-, (E)-;CGA 215944;Fulfill;6-methyl-4-(pyridin-3-ylmethylideneamino)-2,5-dihydro-1,2,4-triazin-3-one;Plenum;1,2,4-Triazin-3(2H)-one, 4,5-dihydro-6-methyl-4-((E)-(3-pyridinylmethylene)amino)-;1,2,4-Triazin-3(2H)-one,4,5-dihydro-6- methyl-4-[(E)-(3-pyridinylmethylene)amino]-;Endeavor;Chess;4,5-dihydro-6-methyl-4-((3-pyridinylmeth-ylene)amino)-1,2,4-triazin-3(2h)-one, (e)-;Pymetrozin; |
| CAS: | 123312-89-0 |
| Molecular Formula: | C10H11N5O |
| Molecular Weight: | 217.23 |
| InChI: | InChI=1/C10H11N5O/c1-8-7-15(10(16)14-13-8)12-6-9-3-2-4-11-5-9/h2-6H,7H2,1H3,(H,14,16)/b12-6+ |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 217oC |
| Density: | 1.33g/cm3 |
| Refractive index: | 1.665 |
| Solubility: | Soluble |
| Appearance: | colorless crystals |
| Specification: |
?Pymetrozine , its cas register number is 123312-89-0. It also can be called Endeavor ; Plenum ; and (E)-4,5-Fihydro-6-methyl-4-((3-pyridinylmethylene)amino)-1,2,4-triazin-3(2H)-one .? |
| Color: | Colorless crystals |
| Usage: | For the control of aphids in brassicas, potatoes and stonefruit . |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
