| Identification | |
| Name: | Adipic acid |
| Synonyms: | FEMA No. 2011;Adipic acid;Hexane diacid;Heptanedoic;1, 4-Butanedicarboxylic acid;Adipinsaeure;Hexan-1,6-dicarboxylate;Kyselina adipova;Inipol DS;hexanedioic acid;1,4-butanedicarboxylic acid;Adipate;Hexanedioate;Adilactetten;Molten adipic acid;Acifloctin;1,6-Hexanedioic acid;Acinetten; |
| CAS: | 124-04-9 |
| EINECS: | 204-673-3 |
| Molecular Formula: | C6H10O4 |
| Molecular Weight: | 146.14 |
| InChI: | InChI=1/C6H10O4/c7-5(8)3-1-2-4-6(9)10/h1-4H2,(H,7,8)(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 9077 |
| Density: | 1.36 g/cm3 |
| Stability: | Stable. Substances to be avoided include ammonia, strong oxidizing agents. |
| Refractive index: | 1.439 |
| Appearance: | White crystalline powder. |
| HS Code: | 29171210 |
| Storage Temperature: | Keep away from sources of ignition. Store in a tightly closed container. Keep from contact with oxidizing materials. Store in a cool, dry, well-ventilated area away from incompatible substances. Keep away from strong bases. |
| Color: | Monoclinic prisms from ethyl acetate, water, or acetone and petroleum ether Fine white crystals or powder White solid Colorless |
| Usage: | Raw material for pharmaceuticals, perfume fixative. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
