| Identification | ||
| Name: | 4,6(1H,5H)-Pyrimidinedione,5-ethyldihydro-5-phenyl- | |
| Synonyms: | 2-Deoxyphenobarbital;2-Desoxyphenobarbital;5-Ethyl-5-phenylhexahydropyrimidine-4,6-dione;5-Ethyldihydro-5-phenyl-4,6(1H,5H)-pyrimidinedione;Resimatil;Roe101;Primakton;Primidon;Pyrimidone Medi-pets;Primacone;Primaclone;Lepimidin;Misodine;Mizolin;Mylepsin;Mysoline;Neurosyn;Sertan;5-Phenyl-5-ethyl-hexahydropyrimidine-4,6-dione;Hexamidine(antiepileptic);Hexamydin;5-Ethylhexahydro-5-phenylpyrimidine-4,6-dione; | |
| CAS: | 125-33-7 | |
| EINECS: | 204-737-0 | |
| Molecular Formula: | C12H14N2O2 | |
| Molecular Weight: | 218.28 | |
| InChI: | InChI=1/C12H14N2O2/c1-2-12(9-6-4-3-5-7-9)10(15)13-8-14-11(12)16/h3-7H,2,8H2,1H3,(H,13,15)(H,14,16) | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | 3249 | |
| Melting Point: | 281-282 ºC | |
| Flash Point: | 228.2°C | |
| Boiling Point: | 520.7°Cat760mmHg | |
| Density: | 1.138g/cm3 | |
| Stability: | No data. | |
| Refractive index: | 1.528 | |
| Water Solubility: | <0.1 g/100 mL at 19 ºC | |
| Solubility: | <0.1 g/100 mL at 19 ºC | |
| Appearance: | Odorless white crystalline powder. Slightly bitter taste. No acidic properties. | |
| Packinggroup: | III | |
| Biological Activity: | Anticonvulsant. | |
| Flash Point: | 228.2°C | |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. | |
| Color: | CRYSTALS WHITE CRYSTALLINE POWDER | |
| Usage: | Anticonvulsant | |
| Safety Data | ||
| Hazard Symbols |
Xn: Harmful
|
|
 |
||
