| Identification | |
| Name: | Cyclobutanemethanamine,1-(4-chlorophenyl)-N,N-dimethyl-a-(2-methylpropyl)-, hydrochloride, hydrate (1:1:1) |
| Synonyms: | Cyclobutanemethanamine,1-(4-chlorophenyl)-N,N-dimethyl-a-(2-methylpropyl)-, hydrochloride, monohydrate (9CI);Sibutraminehydrochloride monohydrate; |
| CAS: | 125494-59-9 |
| Molecular Formula: | C17H29Cl2NO |
| Molecular Weight: | 334.33 |
| InChI: | InChI=1/C17H26ClN.ClH.H2O/c1-13(2)12-16(19(3)4)17(10-5-11-17)14-6-8-15(18)9-7-14;;/h6-9,13,16H,5,10-12H2,1-4H3;1H;1H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 161°C |
| Boiling Point: | 342.6°C at 760 mmHg |
| Solubility: | In water, 2.9 mg/mL at 25 deg C and pH 5.2 |
| Appearance: | white solid |
| Flash Point: | 161°C |
| Storage Temperature: | Room temp |
| Color: | Crystals from water |
| Usage: | A serotonin and noradrenaline reuptake inhibitor (SNR). Decreases calorie intake and increases energy expenditure |
| Safety Data | |
 |
|
