| Identification |
| Name: | 2(5H)-Furanone, 4-[(acetyloxy)chloromethyl]- |
| Synonyms: | AC1L4DJW;(chloro(5-oxo-2h-furan-3-yl)methyl) Acetate;ILVDSUQKKNCONG-UHFFFAOYSA-;[chloro-(5-oxo-2H-furan-3-yl)methyl] acetate;InChI=1/C7H7ClO4/c1-4(9)12-7(8)5-2-6(10)11-3-5/h2,7H,3H2,1H3;125973-98-0 |
| CAS: | 125973-98-0 |
| Molecular Formula: | C7H7 Cl O4 |
| Molecular Weight: | 190.5811 |
| InChI: | InChI=1/C7H7ClO4/c1-4(9)12-7(8)5-2-6(10)11-3-5/h2,7H,3H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 140.5°C |
| Boiling Point: | 304.7°C at 760 mmHg |
| Density: | 1.416g/cm3 |
| Refractive index: | 1.51 |
| Flash Point: | 140.5°C |
| Safety Data |
| |
 |