| Identification | |
| Name: | Zirconium carbonate oxide (Zr3(CO3)O5), monohydrate (9CI) |
| Synonyms: | CO3.H2O.O.Zr; |
| CAS: | 12671-00-0 |
| EINECS: | 260-633-5 |
| Molecular Formula: | Zr3.(CO3).O5 |
| Molecular Weight: | 413.67 |
| InChI: | InChI=1/CH2O3.Zr/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 135 ºC (dec.)(lit.) |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Stability: | Stable. Not flammable. |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | white powder |
| Specification: |
The extinguishing agent of Zirconium carbonate oxide (CAS NO.12671-00-0) are dry powder, foam, sand, carbon dioxide, water mist. |
| Flash Point: | °C |
| Safety Data | |
 |
|
