| Identification |
| Name: | 2-Propanol, 1-chloro- |
| Synonyms: | 1-Chloro-2-hydroxypropane;1-Chloroisopropyl alcohol;NSC77373;sec-Propylene chlorohydrin;a-Propylene chlorohydrin; |
| CAS: | 127-00-4 |
| EINECS: | 204-819-6 |
| Molecular Formula: | C3H7ClO |
| Molecular Weight: | 94.5407 |
| InChI: | InChI=1/C3H7ClO/c1-3(5)2-4/h3,5H,2H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2611 6 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents. |
| Refractive index: | n20/D 1.439(lit.) |
| Appearance: | colourless to light yellow liquid |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Color: | COLORLESS LIQUID |
| Safety Data |
| Hazard Symbols |
Xn: Harmful
|
| |
 |
